About (2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate
(2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate (PubChem CID 157443820) has the molecular formula C31H46ClNO4
and a molecular weight of 532.17 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate.
Molecular Properties
| Compound Name | (2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate |
| PubChem CID | 157443820 |
| Molecular Formula | C31H46ClNO4 |
| Molecular Weight | 532.17 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | (2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate |
| SMILES | CC1(OC(=O)CCCCl)C2CC3CC(C2)CC1C3.[C-]#[N+]CCCC(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C16H23NO2.C15H23ClO2/c1-16(19-15(18)4-3-5-17-2)13-7-11-6-12(9-13)10-14(16)8-11;1-15(18-14(17)3-2-4-16)12-6-10-5-11(8-12)9-13(15)7-10/h11-14H,3-10H2,1H3;10-13H,2-9H2,1H3 |
| InChIKey | BRZHNPWXGJPFQQ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 56.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.17 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate?
The IUPAC name of (2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate (CID 157443820) is (2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate.
What is the SMILES notation for (2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate?
The canonical SMILES for (2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate is CC1(OC(=O)CCCCl)C2CC3CC(C2)CC1C3.[C-]#[N+]CCCC(=O)OC1(C)C2CC3CC(C2)CC1C3.
What is the InChIKey of (2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate?
The InChIKey is BRZHNPWXGJPFQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2.C15H23ClO2/c1-16(19-15(18)4-3-5-17-2)13-7-11-6-12(9-13)10-14(16)8-11;1-15(18-14(17)3-2-4-16)12-6-10-5-11(8-12)9-13(15)7-10/h11-14H,3-10H2,1H3;10-13H,2-9H2,1H3.
What are the key properties of (2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate?
(2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate has a molecular weight of 532.17 g/mol, XLogP of 7.21, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2-adamantyl) 4-chlorobutanoate;(2-methyl-2-adamantyl) 4-isocyanobutanoate is sourced from PubChem (CID 157443820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).