About (2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate
(2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate (PubChem CID 162116029) has the molecular formula C32H49NO5
and a molecular weight of 527.75 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate.
Molecular Properties
| Compound Name | (2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate |
| PubChem CID | 162116029 |
| Molecular Formula | C32H49NO5 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | (2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate |
| SMILES | COCCCC(=O)OC1(C)C2CC3CC(C2)CC1C3.[C-]#[N+]CCCC(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C16H23NO2.C16H26O3/c1-16(19-15(18)4-3-5-17-2)13-7-11-6-12(9-13)10-14(16)8-11;1-16(19-15(17)4-3-5-18-2)13-7-11-6-12(9-13)10-14(16)8-11/h11-14H,3-10H2,1H3;11-14H,3-10H2,1-2H3 |
| InChIKey | ZGTUFMWLXNSLOK-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 66.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate?
The IUPAC name of (2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate (CID 162116029) is (2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate.
What is the SMILES notation for (2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate?
The canonical SMILES for (2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate is COCCCC(=O)OC1(C)C2CC3CC(C2)CC1C3.[C-]#[N+]CCCC(=O)OC1(C)C2CC3CC(C2)CC1C3.
What is the InChIKey of (2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate?
The InChIKey is ZGTUFMWLXNSLOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2.C16H26O3/c1-16(19-15(18)4-3-5-17-2)13-7-11-6-12(9-13)10-14(16)8-11;1-16(19-15(17)4-3-5-18-2)13-7-11-6-12(9-13)10-14(16)8-11/h11-14H,3-10H2,1H3;11-14H,3-10H2,1-2H3.
What are the key properties of (2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate?
(2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate has a molecular weight of 527.75 g/mol, XLogP of 6.61, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2-adamantyl) 4-isocyanobutanoate;(2-methyl-2-adamantyl) 4-methoxybutanoate is sourced from PubChem (CID 162116029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).