C20H25ClO3S2 — CID 157444028
2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-propylsulfanylmethyl]sulfanylethanol (PubChem CID 157444028) has the molecular formula C20H25ClO3S2 and a molecular weight of 413.00 g/mol. Its IUPAC name is 2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-propylsulfanylmethyl]sulfanylethanol.
| Compound Name | 2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-propylsulfanylmethyl]sulfanylethanol |
|---|---|
| PubChem CID | 157444028 |
| Molecular Formula | C20H25ClO3S2 |
| Molecular Weight | 413.00 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 2-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-propylsulfanylmethyl]sulfanylethanol |
| SMILES | CCCSC(SCCO)c1ccc(OCc2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C20H25ClO3S2/c1-3-11-25-20(26-12-10-22)16-6-9-18(19(13-16)23-2)24-14-15-4-7-17(21)8-5-15/h4-9,13,20,22H,3,10-12,14H2,1-2H3 |
| InChIKey | BRZXKMLFFUGNGA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.00 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|