C21H25Br2N3OSi — CID 157444451
4-bromo-7H-cyclopenta[b]pyridine;2-[(4-bromopyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 157444451) has the molecular formula C21H25Br2N3OSi and a molecular weight of 523.35 g/mol. Its IUPAC name is 4-bromo-7H-cyclopenta[b]pyridine;2-[(4-bromopyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 4-bromo-7H-cyclopenta[b]pyridine;2-[(4-bromopyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 157444451 |
| Molecular Formula | C21H25Br2N3OSi |
| Molecular Weight | 523.35 g/mol |
| Exact Mass | 521.01 |
| IUPAC Name | 4-bromo-7H-cyclopenta[b]pyridine;2-[(4-bromopyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | Brc1ccnc2c1C=CC2.C[Si](C)(C)CCOCn1ccc2c(Br)ccnc21 |
| InChI | InChI=1S/C13H19BrN2OSi.C8H6BrN/c1-18(2,3)9-8-17-10-16-7-5-11-12(14)4-6-15-13(11)16;9-7-4-5-10-8-3-1-2-6(7)8/h4-7H,8-10H2,1-3H3;1-2,4-5H,3H2 |
| InChIKey | BSBAMJKRKJWTND-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.35 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|