C16H20F2N2O3 — CID 157445950
(4S,4aS,5R,7R,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-5-(methoxymethyl)-7-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-2-amine (PubChem CID 157445950) has the molecular formula C16H20F2N2O3 and a molecular weight of 326.34 g/mol. Its IUPAC name is (4S,4aS,5R,7R,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-5-(methoxymethyl)-7-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-2-amine.
| Compound Name | (4S,4aS,5R,7R,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-5-(methoxymethyl)-7-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-2-amine |
|---|---|
| PubChem CID | 157445950 |
| Molecular Formula | C16H20F2N2O3 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (4S,4aS,5R,7R,7aS)-4-(fluoromethyl)-4-(2-fluorophenyl)-5-(methoxymethyl)-7-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-2-amine |
| SMILES | COC[C@@H]1O[C@H](C)[C@H]2OC(N)=N[C@](CF)(c3ccccc3F)[C@H]21 |
| InChI | InChI=1S/C16H20F2N2O3/c1-9-14-13(12(22-9)7-21-2)16(8-17,20-15(19)23-14)10-5-3-4-6-11(10)18/h3-6,9,12-14H,7-8H2,1-2H3,(H2,19,20)/t9-,12+,13+,14-,16-/m1/s1 |
| InChIKey | RMFNFIBFQHGSKO-CXITWPJZSA-N |
| XLogP | 1.75 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |