C24H30N4O6 — CID 157453320
ethyl 4-hydroxy-2-oxo-4-pyridin-2-ylbut-3-enoate;ethyl 3-pyridin-2-yl-1H-pyrazole-5-carboxylate;methane (PubChem CID 157453320) has the molecular formula C24H30N4O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is ethyl 4-hydroxy-2-oxo-4-pyridin-2-ylbut-3-enoate;ethyl 3-pyridin-2-yl-1H-pyrazole-5-carboxylate;methane.
| Compound Name | ethyl 4-hydroxy-2-oxo-4-pyridin-2-ylbut-3-enoate;ethyl 3-pyridin-2-yl-1H-pyrazole-5-carboxylate;methane |
|---|---|
| PubChem CID | 157453320 |
| Molecular Formula | C24H30N4O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | ethyl 4-hydroxy-2-oxo-4-pyridin-2-ylbut-3-enoate;ethyl 3-pyridin-2-yl-1H-pyrazole-5-carboxylate;methane |
| SMILES | C.C.CCOC(=O)C(=O)C=C(O)c1ccccn1.CCOC(=O)c1cc(-c2ccccn2)n[nH]1 |
| InChI | InChI=1S/C11H11N3O2.C11H11NO4.2CH4/c1-2-16-11(15)10-7-9(13-14-10)8-5-3-4-6-12-8;1-2-16-11(15)10(14)7-9(13)8-5-3-4-6-12-8;;/h3-7H,2H2,1H3,(H,13,14);3-7,13H,2H2,1H3;2*1H4 |
| InChIKey | USIROAMYCKNQHD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 144.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|