C20H34O5 — CID 157454995
6-methyl-7-[2-[2-(2-methyl-5-oxohept-6-enoxy)ethoxy]ethoxy]hept-1-en-3-one (PubChem CID 157454995) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is 6-methyl-7-[2-[2-(2-methyl-5-oxohept-6-enoxy)ethoxy]ethoxy]hept-1-en-3-one.
| Compound Name | 6-methyl-7-[2-[2-(2-methyl-5-oxohept-6-enoxy)ethoxy]ethoxy]hept-1-en-3-one |
|---|---|
| PubChem CID | 157454995 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 6-methyl-7-[2-[2-(2-methyl-5-oxohept-6-enoxy)ethoxy]ethoxy]hept-1-en-3-one |
| SMILES | C=CC(=O)CCC(C)COCCOCCOCC(C)CCC(=O)C=C |
| InChI | InChI=1S/C20H34O5/c1-5-19(21)9-7-17(3)15-24-13-11-23-12-14-25-16-18(4)8-10-20(22)6-2/h5-6,17-18H,1-2,7-16H2,3-4H3 |
| InChIKey | ZAMZBIBZCCGUAM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|