C22H38O4 — CID 157191803
6-methyl-7-[2-methyl-2-[(2-methyl-5-oxohept-6-enoxy)methyl]butoxy]hept-1-en-3-one (PubChem CID 157191803) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is 6-methyl-7-[2-methyl-2-[(2-methyl-5-oxohept-6-enoxy)methyl]butoxy]hept-1-en-3-one.
| Compound Name | 6-methyl-7-[2-methyl-2-[(2-methyl-5-oxohept-6-enoxy)methyl]butoxy]hept-1-en-3-one |
|---|---|
| PubChem CID | 157191803 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 6-methyl-7-[2-methyl-2-[(2-methyl-5-oxohept-6-enoxy)methyl]butoxy]hept-1-en-3-one |
| SMILES | C=CC(=O)CCC(C)COCC(C)(CC)COCC(C)CCC(=O)C=C |
| InChI | InChI=1S/C22H38O4/c1-7-20(23)12-10-18(4)14-25-16-22(6,9-3)17-26-15-19(5)11-13-21(24)8-2/h7-8,18-19H,1-2,9-17H2,3-6H3 |
| InChIKey | YJVFIOJDVZKSQZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|