C23H40O4 — CID 157191805
7-[3-(2,6-dimethyl-5-oxohept-6-enoxy)-2,2-dimethylpropoxy]-2,6-dimethylhept-1-en-3-one (PubChem CID 157191805) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is 7-[3-(2,6-dimethyl-5-oxohept-6-enoxy)-2,2-dimethylpropoxy]-2,6-dimethylhept-1-en-3-one.
| Compound Name | 7-[3-(2,6-dimethyl-5-oxohept-6-enoxy)-2,2-dimethylpropoxy]-2,6-dimethylhept-1-en-3-one |
|---|---|
| PubChem CID | 157191805 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 7-[3-(2,6-dimethyl-5-oxohept-6-enoxy)-2,2-dimethylpropoxy]-2,6-dimethylhept-1-en-3-one |
| SMILES | C=C(C)C(=O)CCC(C)COCC(C)(C)COCC(C)CCC(=O)C(=C)C |
| InChI | InChI=1S/C23H40O4/c1-17(2)21(24)11-9-19(5)13-26-15-23(7,8)16-27-14-20(6)10-12-22(25)18(3)4/h19-20H,1,3,9-16H2,2,4-8H3 |
| InChIKey | JGHREFNAYSCMHC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|