C17H32O3 — CID 174319576
7-(3-ethoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one (PubChem CID 174319576) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is 7-(3-ethoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one.
| Compound Name | 7-(3-ethoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one |
|---|---|
| PubChem CID | 174319576 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 7-(3-ethoxy-3-methylbutoxy)-2,7-dimethyloct-1-en-3-one |
| SMILES | C=C(C)C(=O)CCCC(C)(C)OCCC(C)(C)OCC |
| InChI | InChI=1S/C17H32O3/c1-8-19-17(6,7)12-13-20-16(4,5)11-9-10-15(18)14(2)3/h2,8-13H2,1,3-7H3 |
| InChIKey | ZFAAKMWYYLZMIH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|