C24H42O4 — CID 157191806
7-[2-[(2,6-dimethyl-5-oxohept-6-enoxy)methyl]-2-methylbutoxy]-2,6-dimethylhept-1-en-3-one (PubChem CID 157191806) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is 7-[2-[(2,6-dimethyl-5-oxohept-6-enoxy)methyl]-2-methylbutoxy]-2,6-dimethylhept-1-en-3-one.
| Compound Name | 7-[2-[(2,6-dimethyl-5-oxohept-6-enoxy)methyl]-2-methylbutoxy]-2,6-dimethylhept-1-en-3-one |
|---|---|
| PubChem CID | 157191806 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 7-[2-[(2,6-dimethyl-5-oxohept-6-enoxy)methyl]-2-methylbutoxy]-2,6-dimethylhept-1-en-3-one |
| SMILES | C=C(C)C(=O)CCC(C)COCC(C)(CC)COCC(C)CCC(=O)C(=C)C |
| InChI | InChI=1S/C24H42O4/c1-9-24(8,16-27-14-20(6)10-12-22(25)18(2)3)17-28-15-21(7)11-13-23(26)19(4)5/h20-21H,2,4,9-17H2,1,3,5-8H3 |
| InChIKey | QQWJKVAXYPHDKK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|