C19H32O2 — CID 142109975
3-ethenylidene-6-[2-(3-ethyl-2,2-dimethylcyclopropyl)propoxy]-5-methylhexan-2-one (PubChem CID 142109975) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 3-ethenylidene-6-[2-(3-ethyl-2,2-dimethylcyclopropyl)propoxy]-5-methylhexan-2-one.
| Compound Name | 3-ethenylidene-6-[2-(3-ethyl-2,2-dimethylcyclopropyl)propoxy]-5-methylhexan-2-one |
|---|---|
| PubChem CID | 142109975 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 3-ethenylidene-6-[2-(3-ethyl-2,2-dimethylcyclopropyl)propoxy]-5-methylhexan-2-one |
| SMILES | C=C=C(CC(C)COCC(C)C1C(CC)C1(C)C)C(C)=O |
| InChI | InChI=1S/C19H32O2/c1-8-16(15(5)20)10-13(3)11-21-12-14(4)18-17(9-2)19(18,6)7/h13-14,17-18H,1,9-12H2,2-7H3 |
| InChIKey | PZPJHRFYYNVMQE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|