C25H44O4 — CID 157191807
7-[2-[(2,6-dimethyl-5-oxohept-6-enoxy)methyl]-2-ethylbutoxy]-2,6-dimethylhept-1-en-3-one (PubChem CID 157191807) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is 7-[2-[(2,6-dimethyl-5-oxohept-6-enoxy)methyl]-2-ethylbutoxy]-2,6-dimethylhept-1-en-3-one.
| Compound Name | 7-[2-[(2,6-dimethyl-5-oxohept-6-enoxy)methyl]-2-ethylbutoxy]-2,6-dimethylhept-1-en-3-one |
|---|---|
| PubChem CID | 157191807 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | 7-[2-[(2,6-dimethyl-5-oxohept-6-enoxy)methyl]-2-ethylbutoxy]-2,6-dimethylhept-1-en-3-one |
| SMILES | C=C(C)C(=O)CCC(C)COCC(CC)(CC)COCC(C)CCC(=O)C(=C)C |
| InChI | InChI=1S/C25H44O4/c1-9-25(10-2,17-28-15-21(7)11-13-23(26)19(3)4)18-29-16-22(8)12-14-24(27)20(5)6/h21-22H,3,5,9-18H2,1-2,4,6-8H3 |
| InChIKey | HIQDWVYZMKZPOE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|