C35H64O4 — CID 157191808
6-methyl-7-[2-[(2-methyl-5-oxohept-6-enoxy)methyl]-2-octyldecoxy]hept-1-en-3-one (PubChem CID 157191808) has the molecular formula C35H64O4 and a molecular weight of 548.89 g/mol. Its IUPAC name is 6-methyl-7-[2-[(2-methyl-5-oxohept-6-enoxy)methyl]-2-octyldecoxy]hept-1-en-3-one.
| Compound Name | 6-methyl-7-[2-[(2-methyl-5-oxohept-6-enoxy)methyl]-2-octyldecoxy]hept-1-en-3-one |
|---|---|
| PubChem CID | 157191808 |
| Molecular Formula | C35H64O4 |
| Molecular Weight | 548.89 g/mol |
| Exact Mass | 548.48 |
| IUPAC Name | 6-methyl-7-[2-[(2-methyl-5-oxohept-6-enoxy)methyl]-2-octyldecoxy]hept-1-en-3-one |
| SMILES | C=CC(=O)CCC(C)COCC(CCCCCCCC)(CCCCCCCC)COCC(C)CCC(=O)C=C |
| InChI | InChI=1S/C35H64O4/c1-7-11-13-15-17-19-25-35(26-20-18-16-14-12-8-2,29-38-27-31(5)21-23-33(36)9-3)30-39-28-32(6)22-24-34(37)10-4/h9-10,31-32H,3-4,7-8,11-30H2,1-2,5-6H3 |
| InChIKey | AEVIWABCBAFSAQ-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.89 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|