C20H32O4 — CID 172511238
7-(4-oxohex-5-enoxymethyl)tridec-1-ene-3,11-dione (PubChem CID 172511238) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 7-(4-oxohex-5-enoxymethyl)tridec-1-ene-3,11-dione.
| Compound Name | 7-(4-oxohex-5-enoxymethyl)tridec-1-ene-3,11-dione |
|---|---|
| PubChem CID | 172511238 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 7-(4-oxohex-5-enoxymethyl)tridec-1-ene-3,11-dione |
| SMILES | C=CC(=O)CCCOCC(CCCC(=O)C=C)CCCC(=O)CC |
| InChI | InChI=1S/C20H32O4/c1-4-18(21)12-7-10-17(11-8-13-19(22)5-2)16-24-15-9-14-20(23)6-3/h4,6,17H,1,3,5,7-16H2,2H3 |
| InChIKey | VRZCTCNFCNSYOI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|