C36H54O6 — CID 89397870
7-[[2-ethyl-6-oxo-2-(4-oxohex-5-enyl)oct-7-enoxy]methyl]-7-(4-oxohex-5-enyl)trideca-1,12-diene-3,11-dione (PubChem CID 89397870) has the molecular formula C36H54O6 and a molecular weight of 582.82 g/mol. Its IUPAC name is 7-[[2-ethyl-6-oxo-2-(4-oxohex-5-enyl)oct-7-enoxy]methyl]-7-(4-oxohex-5-enyl)trideca-1,12-diene-3,11-dione.
| Compound Name | 7-[[2-ethyl-6-oxo-2-(4-oxohex-5-enyl)oct-7-enoxy]methyl]-7-(4-oxohex-5-enyl)trideca-1,12-diene-3,11-dione |
|---|---|
| PubChem CID | 89397870 |
| Molecular Formula | C36H54O6 |
| Molecular Weight | 582.82 g/mol |
| Exact Mass | 582.39 |
| IUPAC Name | 7-[[2-ethyl-6-oxo-2-(4-oxohex-5-enyl)oct-7-enoxy]methyl]-7-(4-oxohex-5-enyl)trideca-1,12-diene-3,11-dione |
| SMILES | C=CC(=O)CCCC(CC)(CCCC(=O)C=C)COCC(CCCC(=O)C=C)(CCCC(=O)C=C)CCCC(=O)C=C |
| InChI | InChI=1S/C36H54O6/c1-7-30(37)18-13-23-35(12-6,24-14-19-31(38)8-2)28-42-29-36(25-15-20-32(39)9-3,26-16-21-33(40)10-4)27-17-22-34(41)11-5/h7-11H,1-5,12-29H2,6H3 |
| InChIKey | ZBZBNQUUKNYOLA-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.82 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|