C24H44O2 — CID 151167904
1-(3-ethyl-2,4-dioctyloxetan-3-yl)prop-2-en-1-one (PubChem CID 151167904) has the molecular formula C24H44O2 and a molecular weight of 364.61 g/mol. Its IUPAC name is 1-(3-ethyl-2,4-dioctyloxetan-3-yl)prop-2-en-1-one.
| Compound Name | 1-(3-ethyl-2,4-dioctyloxetan-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 151167904 |
| Molecular Formula | C24H44O2 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | 1-(3-ethyl-2,4-dioctyloxetan-3-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)C1(CC)C(CCCCCCCC)OC1CCCCCCCC |
| InChI | InChI=1S/C24H44O2/c1-5-9-11-13-15-17-19-22-24(8-4,21(25)7-3)23(26-22)20-18-16-14-12-10-6-2/h7,22-23H,3,5-6,8-20H2,1-2,4H3 |
| InChIKey | NBQQXSICBQSEIQ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|