C14H24O2 — CID 102053347
(2R)-2-heptyl-3,3-dimethyl-2H-pyran-4-one (PubChem CID 102053347) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (2R)-2-heptyl-3,3-dimethyl-2H-pyran-4-one.
| Compound Name | (2R)-2-heptyl-3,3-dimethyl-2H-pyran-4-one |
|---|---|
| PubChem CID | 102053347 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (2R)-2-heptyl-3,3-dimethyl-2H-pyran-4-one |
| SMILES | CCCCCCC[C@H]1OC=CC(=O)C1(C)C |
| InChI | InChI=1S/C14H24O2/c1-4-5-6-7-8-9-13-14(2,3)12(15)10-11-16-13/h10-11,13H,4-9H2,1-3H3/t13-/m1/s1 |
| InChIKey | ROLOIMOBRRVBLP-CYBMUJFWSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|