C16H26O2 — CID 46179924
3-ethoxy-2,2-bis(pent-4-enyl)cyclobutan-1-one (PubChem CID 46179924) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 3-ethoxy-2,2-bis(pent-4-enyl)cyclobutan-1-one.
| Compound Name | 3-ethoxy-2,2-bis(pent-4-enyl)cyclobutan-1-one |
|---|---|
| PubChem CID | 46179924 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 3-ethoxy-2,2-bis(pent-4-enyl)cyclobutan-1-one |
| SMILES | C=CCCCC1(CCCC=C)C(=O)CC1OCC |
| InChI | InChI=1S/C16H26O2/c1-4-7-9-11-16(12-10-8-5-2)14(17)13-15(16)18-6-3/h4-5,15H,1-2,6-13H2,3H3 |
| InChIKey | QIPOZCSSCOXDHW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|