C40H58O7 — CID 89397899
7-[[6-oxo-2,2-bis(4-oxohex-5-enyl)oct-7-enoxy]methyl]-7-(4-oxohex-5-enyl)trideca-1,12-diene-3,11-dione (PubChem CID 89397899) has the molecular formula C40H58O7 and a molecular weight of 650.90 g/mol. Its IUPAC name is 7-[[6-oxo-2,2-bis(4-oxohex-5-enyl)oct-7-enoxy]methyl]-7-(4-oxohex-5-enyl)trideca-1,12-diene-3,11-dione.
| Compound Name | 7-[[6-oxo-2,2-bis(4-oxohex-5-enyl)oct-7-enoxy]methyl]-7-(4-oxohex-5-enyl)trideca-1,12-diene-3,11-dione |
|---|---|
| PubChem CID | 89397899 |
| Molecular Formula | C40H58O7 |
| Molecular Weight | 650.90 g/mol |
| Exact Mass | 650.42 |
| IUPAC Name | 7-[[6-oxo-2,2-bis(4-oxohex-5-enyl)oct-7-enoxy]methyl]-7-(4-oxohex-5-enyl)trideca-1,12-diene-3,11-dione |
| SMILES | C=CC(=O)CCCC(CCCC(=O)C=C)(CCCC(=O)C=C)COCC(CCCC(=O)C=C)(CCCC(=O)C=C)CCCC(=O)C=C |
| InChI | InChI=1S/C40H58O7/c1-7-33(41)19-13-25-39(26-14-20-34(42)8-2,27-15-21-35(43)9-3)31-47-32-40(28-16-22-36(44)10-4,29-17-23-37(45)11-5)30-18-24-38(46)12-6/h7-12H,1-6,13-32H2 |
| InChIKey | ZQJRQCRVKALDPA-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 111.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.90 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|