C23H40O4 — CID 58421170
ethyl (2R)-4-oxo-2-(6-oxooct-7-enyl)tridecanoate (PubChem CID 58421170) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is ethyl (2R)-4-oxo-2-(6-oxooct-7-enyl)tridecanoate.
| Compound Name | ethyl (2R)-4-oxo-2-(6-oxooct-7-enyl)tridecanoate |
|---|---|
| PubChem CID | 58421170 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | ethyl (2R)-4-oxo-2-(6-oxooct-7-enyl)tridecanoate |
| SMILES | C=CC(=O)CCCCC[C@H](CC(=O)CCCCCCCCC)C(=O)OCC |
| InChI | InChI=1S/C23H40O4/c1-4-7-8-9-10-11-14-18-22(25)19-20(23(26)27-6-3)16-13-12-15-17-21(24)5-2/h5,20H,2,4,6-19H2,1,3H3/t20-/m1/s1 |
| InChIKey | CIACXJYADXMQBU-HXUWFJFHSA-N |
| XLogP | 5.97 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|