C37H68O4 — CID 157191809
7-[2-[(2,6-dimethyl-5-oxohept-6-enoxy)methyl]-2-octyldecoxy]-2,6-dimethylhept-1-en-3-one (PubChem CID 157191809) has the molecular formula C37H68O4 and a molecular weight of 576.95 g/mol. Its IUPAC name is 7-[2-[(2,6-dimethyl-5-oxohept-6-enoxy)methyl]-2-octyldecoxy]-2,6-dimethylhept-1-en-3-one.
| Compound Name | 7-[2-[(2,6-dimethyl-5-oxohept-6-enoxy)methyl]-2-octyldecoxy]-2,6-dimethylhept-1-en-3-one |
|---|---|
| PubChem CID | 157191809 |
| Molecular Formula | C37H68O4 |
| Molecular Weight | 576.95 g/mol |
| Exact Mass | 576.51 |
| IUPAC Name | 7-[2-[(2,6-dimethyl-5-oxohept-6-enoxy)methyl]-2-octyldecoxy]-2,6-dimethylhept-1-en-3-one |
| SMILES | C=C(C)C(=O)CCC(C)COCC(CCCCCCCC)(CCCCCCCC)COCC(C)CCC(=O)C(=C)C |
| InChI | InChI=1S/C37H68O4/c1-9-11-13-15-17-19-25-37(26-20-18-16-14-12-10-2,29-40-27-33(7)21-23-35(38)31(3)4)30-41-28-34(8)22-24-36(39)32(5)6/h33-34H,3,5,9-30H2,1-2,4,6-8H3 |
| InChIKey | PNMUUUDJZGZXAZ-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.95 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|