C24H38O6 — CID 59769055
6-[2,2-bis(4-oxohex-5-enoxymethyl)butoxy]hex-1-en-3-one (PubChem CID 59769055) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is 6-[2,2-bis(4-oxohex-5-enoxymethyl)butoxy]hex-1-en-3-one.
| Compound Name | 6-[2,2-bis(4-oxohex-5-enoxymethyl)butoxy]hex-1-en-3-one |
|---|---|
| PubChem CID | 59769055 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 6-[2,2-bis(4-oxohex-5-enoxymethyl)butoxy]hex-1-en-3-one |
| SMILES | C=CC(=O)CCCOCC(CC)(COCCCC(=O)C=C)COCCCC(=O)C=C |
| InChI | InChI=1S/C24H38O6/c1-5-21(25)12-9-15-28-18-24(8-4,19-29-16-10-13-22(26)6-2)20-30-17-11-14-23(27)7-3/h5-7H,1-3,8-20H2,4H3 |
| InChIKey | IXXSJYMBYWRMKA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|