C26H40O9 — CID 91381358
2,2-bis(prop-2-enoyloxymethyl)butyl butanoate;4-oxohex-5-enyl butanoate (PubChem CID 91381358) has the molecular formula C26H40O9 and a molecular weight of 496.60 g/mol. Its IUPAC name is 2,2-bis(prop-2-enoyloxymethyl)butyl butanoate;4-oxohex-5-enyl butanoate.
| Compound Name | 2,2-bis(prop-2-enoyloxymethyl)butyl butanoate;4-oxohex-5-enyl butanoate |
|---|---|
| PubChem CID | 91381358 |
| Molecular Formula | C26H40O9 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | 2,2-bis(prop-2-enoyloxymethyl)butyl butanoate;4-oxohex-5-enyl butanoate |
| SMILES | C=CC(=O)CCCOC(=O)CCC.C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)CCC |
| InChI | InChI=1S/C16H24O6.C10H16O3/c1-5-9-15(19)22-12-16(8-4,10-20-13(17)6-2)11-21-14(18)7-3;1-3-6-10(12)13-8-5-7-9(11)4-2/h6-7H,2-3,5,8-12H2,1,4H3;4H,2-3,5-8H2,1H3 |
| InChIKey | LHJIOVIHBLZEIA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|