(2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate

C11H16O3 — CID 58769644

IUPAC(2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate
SMILESC=CC(=O)CC(C)(C)COC(=O)C=C
InChIInChI=1S/C11H16O3/c1-5-9(12)7-11(3,4)8-14-10(13)6-2/h5-6H,1-2,7-8H2,3-4H3
InChIKeyIPAKPIHBOGAKIP-UHFFFAOYSA-N
MW196.25 g/mol
LogP1.89
Rot. Bonds6

About (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate

(2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate (PubChem CID 58769644) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate.

Molecular Properties

Compound Name(2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate
PubChem CID58769644
Molecular FormulaC11H16O3
Molecular Weight196.25 g/mol
Exact Mass196.11
IUPAC Name(2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate
SMILESC=CC(=O)CC(C)(C)COC(=O)C=C
InChIInChI=1S/C11H16O3/c1-5-9(12)7-11(3,4)8-14-10(13)6-2/h5-6H,1-2,7-8H2,3-4H3
InChIKeyIPAKPIHBOGAKIP-UHFFFAOYSA-N
XLogP1.89
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.25
LogP ≤ 51.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate?
The IUPAC name of (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate (CID 58769644) is (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate.
What is the SMILES notation for (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate?
The canonical SMILES for (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate is C=CC(=O)CC(C)(C)COC(=O)C=C.
What is the InChIKey of (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate?
The InChIKey is IPAKPIHBOGAKIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-5-9(12)7-11(3,4)8-14-10(13)6-2/h5-6H,1-2,7-8H2,3-4H3.
What are the key properties of (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate?
(2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate has a molecular weight of 196.25 g/mol, XLogP of 1.89, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate is sourced from PubChem (CID 58769644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).