C11H16O3 — CID 58769644
(2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate (PubChem CID 58769644) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate.
| Compound Name | (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate |
|---|---|
| PubChem CID | 58769644 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate |
| SMILES | C=CC(=O)CC(C)(C)COC(=O)C=C |
| InChI | InChI=1S/C11H16O3/c1-5-9(12)7-11(3,4)8-14-10(13)6-2/h5-6H,1-2,7-8H2,3-4H3 |
| InChIKey | IPAKPIHBOGAKIP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|