C18H30O5 — CID 59499819
1-[2,2-dimethyl-3-(2-methyl-4-oxohex-5-enoxy)propoxy]propan-2-yl prop-2-enoate (PubChem CID 59499819) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is 1-[2,2-dimethyl-3-(2-methyl-4-oxohex-5-enoxy)propoxy]propan-2-yl prop-2-enoate.
| Compound Name | 1-[2,2-dimethyl-3-(2-methyl-4-oxohex-5-enoxy)propoxy]propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 59499819 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 1-[2,2-dimethyl-3-(2-methyl-4-oxohex-5-enoxy)propoxy]propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)CC(C)COCC(C)(C)COCC(C)OC(=O)C=C |
| InChI | InChI=1S/C18H30O5/c1-7-16(19)9-14(3)10-21-12-18(5,6)13-22-11-15(4)23-17(20)8-2/h7-8,14-15H,1-2,9-13H2,3-6H3 |
| InChIKey | KNKJZHVALOUPAE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|