About [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate
[2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate (PubChem CID 89325013) has the molecular formula C17H28O5
and a molecular weight of 312.41 g/mol. Its IUPAC name is [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate.
Molecular Properties
| Compound Name | [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate |
| PubChem CID | 89325013 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate |
| SMILES | C=CC(=O)CC(C)(C)COCC(CC)(CO)COC(=O)C=C |
| InChI | InChI=1S/C17H28O5/c1-6-14(19)9-16(4,5)11-21-12-17(8-3,10-18)13-22-15(20)7-2/h6-7,18H,1-2,8-13H2,3-5H3 |
| InChIKey | KQOHABQHZDMCQB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate?
The IUPAC name of [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate (CID 89325013) is [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate.
What is the SMILES notation for [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate?
The canonical SMILES for [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate is C=CC(=O)CC(C)(C)COCC(CC)(CO)COC(=O)C=C.
What is the InChIKey of [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate?
The InChIKey is KQOHABQHZDMCQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O5/c1-6-14(19)9-16(4,5)11-21-12-17(8-3,10-18)13-22-15(20)7-2/h6-7,18H,1-2,8-13H2,3-5H3.
What are the key properties of [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate?
[2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate has a molecular weight of 312.41 g/mol, XLogP of 2.29, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate is sourced from PubChem (CID 89325013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).