C17H28O5 — CID 89325013
[2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate (PubChem CID 89325013) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate.
| Compound Name | [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate |
|---|---|
| PubChem CID | 89325013 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [2-[(2,2-dimethyl-4-oxohex-5-enoxy)methyl]-2-(hydroxymethyl)butyl] prop-2-enoate |
| SMILES | C=CC(=O)CC(C)(C)COCC(CC)(CO)COC(=O)C=C |
| InChI | InChI=1S/C17H28O5/c1-6-14(19)9-16(4,5)11-21-12-17(8-3,10-18)13-22-15(20)7-2/h6-7,18H,1-2,8-13H2,3-5H3 |
| InChIKey | KQOHABQHZDMCQB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|