C17H28O5 — CID 58769626
1-[2,2-dimethyl-3-(2-methyl-3-oxopent-4-enoxy)propoxy]propan-2-yl prop-2-enoate (PubChem CID 58769626) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-[2,2-dimethyl-3-(2-methyl-3-oxopent-4-enoxy)propoxy]propan-2-yl prop-2-enoate.
| Compound Name | 1-[2,2-dimethyl-3-(2-methyl-3-oxopent-4-enoxy)propoxy]propan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 58769626 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 1-[2,2-dimethyl-3-(2-methyl-3-oxopent-4-enoxy)propoxy]propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)COCC(C)(C)COCC(C)C(=O)C=C |
| InChI | InChI=1S/C17H28O5/c1-7-15(18)13(3)9-20-11-17(5,6)12-21-10-14(4)22-16(19)8-2/h7-8,13-14H,1-2,9-12H2,3-6H3 |
| InChIKey | FCUUXGWHJSQABW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|