C20H40O5 — CID 157497342
2-butoxyethyl prop-2-enoate;5-butoxypent-1-en-3-one;methane (PubChem CID 157497342) has the molecular formula C20H40O5 and a molecular weight of 360.54 g/mol. Its IUPAC name is 2-butoxyethyl prop-2-enoate;5-butoxypent-1-en-3-one;methane.
| Compound Name | 2-butoxyethyl prop-2-enoate;5-butoxypent-1-en-3-one;methane |
|---|---|
| PubChem CID | 157497342 |
| Molecular Formula | C20H40O5 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | 2-butoxyethyl prop-2-enoate;5-butoxypent-1-en-3-one;methane |
| SMILES | C.C.C=CC(=O)CCOCCCC.C=CC(=O)OCCOCCCC |
| InChI | InChI=1S/C9H16O3.C9H16O2.2CH4/c1-3-5-6-11-7-8-12-9(10)4-2;1-3-5-7-11-8-6-9(10)4-2;;/h4H,2-3,5-8H2,1H3;4H,2-3,5-8H2,1H3;2*1H4 |
| InChIKey | BXZKFGJCLDJOBB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|