C12H18O4 — CID 58769643
2-(2-methyl-3-oxopent-4-enoxy)propyl prop-2-enoate (PubChem CID 58769643) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-(2-methyl-3-oxopent-4-enoxy)propyl prop-2-enoate.
| Compound Name | 2-(2-methyl-3-oxopent-4-enoxy)propyl prop-2-enoate |
|---|---|
| PubChem CID | 58769643 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-(2-methyl-3-oxopent-4-enoxy)propyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)OCC(C)C(=O)C=C |
| InChI | InChI=1S/C12H18O4/c1-5-11(13)9(3)7-15-10(4)8-16-12(14)6-2/h5-6,9-10H,1-2,7-8H2,3-4H3 |
| InChIKey | HSNBVXFZKDZYNF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|