C24H26O12 — CID 134921771
2,2-bis(4,6-dioxohex-5-enoyloxymethyl)butyl 4,6-dioxohex-5-enoate (PubChem CID 134921771) has the molecular formula C24H26O12 and a molecular weight of 506.46 g/mol. Its IUPAC name is 2,2-bis(4,6-dioxohex-5-enoyloxymethyl)butyl 4,6-dioxohex-5-enoate.
| Compound Name | 2,2-bis(4,6-dioxohex-5-enoyloxymethyl)butyl 4,6-dioxohex-5-enoate |
|---|---|
| PubChem CID | 134921771 |
| Molecular Formula | C24H26O12 |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 2,2-bis(4,6-dioxohex-5-enoyloxymethyl)butyl 4,6-dioxohex-5-enoate |
| SMILES | CCC(COC(=O)CCC(=O)C=C=O)(COC(=O)CCC(=O)C=C=O)COC(=O)CCC(=O)C=C=O |
| InChI | InChI=1S/C24H26O12/c1-2-24(15-34-21(31)6-3-18(28)9-12-25,16-35-22(32)7-4-19(29)10-13-26)17-36-23(33)8-5-20(30)11-14-27/h9-11H,2-8,15-17H2,1H3 |
| InChIKey | FARIFWPGMLPYMB-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 181.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|