C16H22O5 — CID 169221805
(2,2-dimethyl-4-oxohex-5-enoyl) 2,2-dimethyl-4-oxohex-5-enoate (PubChem CID 169221805) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is (2,2-dimethyl-4-oxohex-5-enoyl) 2,2-dimethyl-4-oxohex-5-enoate.
| Compound Name | (2,2-dimethyl-4-oxohex-5-enoyl) 2,2-dimethyl-4-oxohex-5-enoate |
|---|---|
| PubChem CID | 169221805 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (2,2-dimethyl-4-oxohex-5-enoyl) 2,2-dimethyl-4-oxohex-5-enoate |
| SMILES | C=CC(=O)CC(C)(C)C(=O)OC(=O)C(C)(C)CC(=O)C=C |
| InChI | InChI=1S/C16H22O5/c1-7-11(17)9-15(3,4)13(19)21-14(20)16(5,6)10-12(18)8-2/h7-8H,1-2,9-10H2,3-6H3 |
| InChIKey | JCTPGFXGTFQJKR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|