C18H26O5 — CID 169221873
(2,2,3-trimethyl-4-oxohex-5-enoyl) 2,2,3-trimethyl-4-oxohex-5-enoate (PubChem CID 169221873) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is (2,2,3-trimethyl-4-oxohex-5-enoyl) 2,2,3-trimethyl-4-oxohex-5-enoate.
| Compound Name | (2,2,3-trimethyl-4-oxohex-5-enoyl) 2,2,3-trimethyl-4-oxohex-5-enoate |
|---|---|
| PubChem CID | 169221873 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (2,2,3-trimethyl-4-oxohex-5-enoyl) 2,2,3-trimethyl-4-oxohex-5-enoate |
| SMILES | C=CC(=O)C(C)C(C)(C)C(=O)OC(=O)C(C)(C)C(C)C(=O)C=C |
| InChI | InChI=1S/C18H26O5/c1-9-13(19)11(3)17(5,6)15(21)23-16(22)18(7,8)12(4)14(20)10-2/h9-12H,1-2H2,3-8H3 |
| InChIKey | KHZDNNZTCITUQH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|