C20H30O5 — CID 169221779
(2,2,3,5-tetramethyl-4-oxohex-5-enoyl) 2,2,3,5-tetramethyl-4-oxohex-5-enoate (PubChem CID 169221779) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2,2,3,5-tetramethyl-4-oxohex-5-enoyl) 2,2,3,5-tetramethyl-4-oxohex-5-enoate.
| Compound Name | (2,2,3,5-tetramethyl-4-oxohex-5-enoyl) 2,2,3,5-tetramethyl-4-oxohex-5-enoate |
|---|---|
| PubChem CID | 169221779 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (2,2,3,5-tetramethyl-4-oxohex-5-enoyl) 2,2,3,5-tetramethyl-4-oxohex-5-enoate |
| SMILES | C=C(C)C(=O)C(C)C(C)(C)C(=O)OC(=O)C(C)(C)C(C)C(=O)C(=C)C |
| InChI | InChI=1S/C20H30O5/c1-11(2)15(21)13(5)19(7,8)17(23)25-18(24)20(9,10)14(6)16(22)12(3)4/h13-14H,1,3H2,2,4-10H3 |
| InChIKey | QLYGNXQRYAGHJV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|