C22H34O5 — CID 169221865
(3-ethyl-2,2,5-trimethyl-4-oxohex-5-enoyl) 3-ethyl-2,2,5-trimethyl-4-oxohex-5-enoate (PubChem CID 169221865) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (3-ethyl-2,2,5-trimethyl-4-oxohex-5-enoyl) 3-ethyl-2,2,5-trimethyl-4-oxohex-5-enoate.
| Compound Name | (3-ethyl-2,2,5-trimethyl-4-oxohex-5-enoyl) 3-ethyl-2,2,5-trimethyl-4-oxohex-5-enoate |
|---|---|
| PubChem CID | 169221865 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (3-ethyl-2,2,5-trimethyl-4-oxohex-5-enoyl) 3-ethyl-2,2,5-trimethyl-4-oxohex-5-enoate |
| SMILES | C=C(C)C(=O)C(CC)C(C)(C)C(=O)OC(=O)C(C)(C)C(CC)C(=O)C(=C)C |
| InChI | InChI=1S/C22H34O5/c1-11-15(17(23)13(3)4)21(7,8)19(25)27-20(26)22(9,10)16(12-2)18(24)14(5)6/h15-16H,3,5,11-12H2,1-2,4,6-10H3 |
| InChIKey | SUQXRBDFONFNAK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|