C11H18O3 — CID 171736259
propyl 2,2-dimethyl-4-oxohex-5-enoate (PubChem CID 171736259) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is propyl 2,2-dimethyl-4-oxohex-5-enoate.
| Compound Name | propyl 2,2-dimethyl-4-oxohex-5-enoate |
|---|---|
| PubChem CID | 171736259 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | propyl 2,2-dimethyl-4-oxohex-5-enoate |
| SMILES | C=CC(=O)CC(C)(C)C(=O)OCCC |
| InChI | InChI=1S/C11H18O3/c1-5-7-14-10(13)11(3,4)8-9(12)6-2/h6H,2,5,7-8H2,1,3-4H3 |
| InChIKey | NUNMDOMGNHJUDD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|