C23H38O10 — CID 160580495
ethyl 3-[2,2-bis[(3-ethoxy-3-oxopropoxy)methyl]-4-oxohex-5-enoxy]propanoate (PubChem CID 160580495) has the molecular formula C23H38O10 and a molecular weight of 474.55 g/mol. Its IUPAC name is ethyl 3-[2,2-bis[(3-ethoxy-3-oxopropoxy)methyl]-4-oxohex-5-enoxy]propanoate.
| Compound Name | ethyl 3-[2,2-bis[(3-ethoxy-3-oxopropoxy)methyl]-4-oxohex-5-enoxy]propanoate |
|---|---|
| PubChem CID | 160580495 |
| Molecular Formula | C23H38O10 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | ethyl 3-[2,2-bis[(3-ethoxy-3-oxopropoxy)methyl]-4-oxohex-5-enoxy]propanoate |
| SMILES | C=CC(=O)CC(COCCC(=O)OCC)(COCCC(=O)OCC)COCCC(=O)OCC |
| InChI | InChI=1S/C23H38O10/c1-5-19(24)15-23(16-28-12-9-20(25)31-6-2,17-29-13-10-21(26)32-7-3)18-30-14-11-22(27)33-8-4/h5H,1,6-18H2,2-4H3 |
| InChIKey | RBSHHLHHOXTFSN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|