C19H26O6 — CID 91280021
(2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate;3-oxopent-4-enyl prop-2-enoate (PubChem CID 91280021) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate;3-oxopent-4-enyl prop-2-enoate.
| Compound Name | (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate;3-oxopent-4-enyl prop-2-enoate |
|---|---|
| PubChem CID | 91280021 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (2,2-dimethyl-4-oxohex-5-enyl) prop-2-enoate;3-oxopent-4-enyl prop-2-enoate |
| SMILES | C=CC(=O)CC(C)(C)COC(=O)C=C.C=CC(=O)CCOC(=O)C=C |
| InChI | InChI=1S/C11H16O3.C8H10O3/c1-5-9(12)7-11(3,4)8-14-10(13)6-2;1-3-7(9)5-6-11-8(10)4-2/h5-6H,1-2,7-8H2,3-4H3;3-4H,1-2,5-6H2 |
| InChIKey | XZTMUBXONGBBSU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|