About but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one
but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one (PubChem CID 157124185) has the molecular formula C19H36O5
and a molecular weight of 344.49 g/mol. Its IUPAC name is but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one.
Molecular Properties
| Compound Name | but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one |
| PubChem CID | 157124185 |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one |
| SMILES | C=CC(=O)C(C)C.C=CC(C)=O.CCC(COC)(COC)COC |
| InChI | InChI=1S/C9H20O3.C6H10O.C4H6O/c1-5-9(6-10-2,7-11-3)8-12-4;1-4-6(7)5(2)3;1-3-4(2)5/h5-8H2,1-4H3;4-5H,1H2,2-3H3;3H,1H2,2H3 |
| InChIKey | AIIAOTQBEGVPAF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one?
The IUPAC name of but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one (CID 157124185) is but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one.
What is the SMILES notation for but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one?
The canonical SMILES for but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one is C=CC(=O)C(C)C.C=CC(C)=O.CCC(COC)(COC)COC.
What is the InChIKey of but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one?
The InChIKey is AIIAOTQBEGVPAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O3.C6H10O.C4H6O/c1-5-9(6-10-2,7-11-3)8-12-4;1-4-6(7)5(2)3;1-3-4(2)5/h5-8H2,1-4H3;4-5H,1H2,2-3H3;3H,1H2,2H3.
What are the key properties of but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one?
but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one has a molecular weight of 344.49 g/mol, XLogP of 3.48, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-one;1-methoxy-2,2-bis(methoxymethyl)butane;4-methylpent-1-en-3-one is sourced from PubChem (CID 157124185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).