C15H32O5 — CID 161016512
1,3-dimethoxy-2,2-bis(methoxymethyl)propane;methane;pent-1-en-3-one (PubChem CID 161016512) has the molecular formula C15H32O5 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1,3-dimethoxy-2,2-bis(methoxymethyl)propane;methane;pent-1-en-3-one.
| Compound Name | 1,3-dimethoxy-2,2-bis(methoxymethyl)propane;methane;pent-1-en-3-one |
|---|---|
| PubChem CID | 161016512 |
| Molecular Formula | C15H32O5 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1,3-dimethoxy-2,2-bis(methoxymethyl)propane;methane;pent-1-en-3-one |
| SMILES | C.C=CC(=O)CC.COCC(COC)(COC)COC |
| InChI | InChI=1S/C9H20O4.C5H8O.CH4/c1-10-5-9(6-11-2,7-12-3)8-13-4;1-3-5(6)4-2;/h5-8H2,1-4H3;3H,1,4H2,2H3;1H4 |
| InChIKey | TXUIRHOFJVNGNS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|