About but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane
but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane (PubChem CID 91401070) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane.
Molecular Properties
| Compound Name | but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane |
| PubChem CID | 91401070 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane |
| SMILES | C=CC(C)=O.COCC1(C)COC1 |
| InChI | InChI=1S/C6H12O2.C4H6O/c1-6(3-7-2)4-8-5-6;1-3-4(2)5/h3-5H2,1-2H3;3H,1H2,2H3 |
| InChIKey | FRCHDTSCDZAZAY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane?
The IUPAC name of but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane (CID 91401070) is but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane.
What is the SMILES notation for but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane?
The canonical SMILES for but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane is C=CC(C)=O.COCC1(C)COC1.
What is the InChIKey of but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane?
The InChIKey is FRCHDTSCDZAZAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C4H6O/c1-6(3-7-2)4-8-5-6;1-3-4(2)5/h3-5H2,1-2H3;3H,1H2,2H3.
What are the key properties of but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane?
but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane has a molecular weight of 186.25 g/mol, XLogP of 1.43, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-one;3-(methoxymethyl)-3-methyloxetane is sourced from PubChem (CID 91401070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).