C28H44N4O6Si — CID 157455234
4-amino-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]-5-[[(1S)-2,2-dimethyl-1-(2-nitrophenyl)propoxy]methyl]pyrimidin-2-one (PubChem CID 157455234) has the molecular formula C28H44N4O6Si and a molecular weight of 560.77 g/mol. Its IUPAC name is 4-amino-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]-5-[[(1S)-2,2-dimethyl-1-(2-nitrophenyl)propoxy]methyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]-5-[[(1S)-2,2-dimethyl-1-(2-nitrophenyl)propoxy]methyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 157455234 |
| Molecular Formula | C28H44N4O6Si |
| Molecular Weight | 560.77 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | 4-amino-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-ethyloxolan-2-yl]-5-[[(1S)-2,2-dimethyl-1-(2-nitrophenyl)propoxy]methyl]pyrimidin-2-one |
| SMILES | CC[C@H]1O[C@@H](n2cc(CO[C@H](c3ccccc3[N+](=O)[O-])C(C)(C)C)c(N)nc2=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H44N4O6Si/c1-10-21-22(38-39(8,9)28(5,6)7)15-23(37-21)31-16-18(25(29)30-26(31)33)17-36-24(27(2,3)4)19-13-11-12-14-20(19)32(34)35/h11-14,16,21-24H,10,15,17H2,1-9H3,(H2,29,30,33)/t21-,22-,23-,24-/m1/s1 |
| InChIKey | VRAJABXPKUQGNJ-MOUTVQLLSA-N |
| XLogP | 6.13 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.77 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|