C36H41BBr2N2O2 — CID 157455883
6-bromo-1,5-dimethylindole;6-bromo-5-methyl-1H-indene;1,5-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 157455883) has the molecular formula C36H41BBr2N2O2 and a molecular weight of 704.36 g/mol. Its IUPAC name is 6-bromo-1,5-dimethylindole;6-bromo-5-methyl-1H-indene;1,5-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 6-bromo-1,5-dimethylindole;6-bromo-5-methyl-1H-indene;1,5-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 157455883 |
| Molecular Formula | C36H41BBr2N2O2 |
| Molecular Weight | 704.36 g/mol |
| Exact Mass | 702.16 |
| IUPAC Name | 6-bromo-1,5-dimethylindole;6-bromo-5-methyl-1H-indene;1,5-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | Cc1cc2c(cc1Br)CC=C2.Cc1cc2ccn(C)c2cc1B1OC(C)(C)C(C)(C)O1.Cc1cc2ccn(C)c2cc1Br |
| InChI | InChI=1S/C16H22BNO2.C10H10BrN.C10H9Br/c1-11-9-12-7-8-18(6)14(12)10-13(11)17-19-15(2,3)16(4,5)20-17;1-7-5-8-3-4-12(2)10(8)6-9(7)11;1-7-5-8-3-2-4-9(8)6-10(7)11/h7-10H,1-6H3;3-6H,1-2H3;2-3,5-6H,4H2,1H3 |
| InChIKey | BTITXLFSQIXQHF-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.36 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|