C27H22ClFN4O3 — CID 157459242
6-(3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-2-ylmethyl)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine (PubChem CID 157459242) has the molecular formula C27H22ClFN4O3 and a molecular weight of 504.95 g/mol. Its IUPAC name is 6-(3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-2-ylmethyl)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine.
| Compound Name | 6-(3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-2-ylmethyl)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 157459242 |
| Molecular Formula | C27H22ClFN4O3 |
| Molecular Weight | 504.95 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 6-(3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-2-ylmethyl)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine |
| SMILES | Fc1cccc(COc2ccc(Nc3ncnc4ccc(CC5=NC6COCC6O5)cc34)cc2Cl)c1 |
| InChI | InChI=1S/C27H22ClFN4O3/c28-21-11-19(5-7-24(21)35-12-17-2-1-3-18(29)8-17)32-27-20-9-16(4-6-22(20)30-15-31-27)10-26-33-23-13-34-14-25(23)36-26/h1-9,11,15,23,25H,10,12-14H2,(H,30,31,32) |
| InChIKey | MNGXRZMDAPZIRP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.95 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |