C26H42N6O5 — CID 157461015
1-(4-amino-3-methoxyphenyl)-4-(2-hydroxyethylamino)pyrrolidin-3-ol;1-(4-amino-3-methylphenyl)-4-(2-hydroxyethylamino)pyrrolidin-3-ol (PubChem CID 157461015) has the molecular formula C26H42N6O5 and a molecular weight of 518.66 g/mol. Its IUPAC name is 1-(4-amino-3-methoxyphenyl)-4-(2-hydroxyethylamino)pyrrolidin-3-ol;1-(4-amino-3-methylphenyl)-4-(2-hydroxyethylamino)pyrrolidin-3-ol.
| Compound Name | 1-(4-amino-3-methoxyphenyl)-4-(2-hydroxyethylamino)pyrrolidin-3-ol;1-(4-amino-3-methylphenyl)-4-(2-hydroxyethylamino)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 157461015 |
| Molecular Formula | C26H42N6O5 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | 1-(4-amino-3-methoxyphenyl)-4-(2-hydroxyethylamino)pyrrolidin-3-ol;1-(4-amino-3-methylphenyl)-4-(2-hydroxyethylamino)pyrrolidin-3-ol |
| SMILES | COc1cc(N2CC(O)C(NCCO)C2)ccc1N.Cc1cc(N2CC(O)C(NCCO)C2)ccc1N |
| InChI | InChI=1S/C13H21N3O3.C13H21N3O2/c1-19-13-6-9(2-3-10(13)14)16-7-11(12(18)8-16)15-4-5-17;1-9-6-10(2-3-11(9)14)16-7-12(13(18)8-16)15-4-5-17/h2-3,6,11-12,15,17-18H,4-5,7-8,14H2,1H3;2-3,6,12-13,15,17-18H,4-5,7-8,14H2,1H3 |
| InChIKey | BTXOWABVEQQPSZ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 172.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|