C18H27B2NO2 — CID 157461920
CID 157461920 (PubChem CID 157461920) has the molecular formula C18H27B2NO2 and a molecular weight of 311.04 g/mol.
| Compound Name | CID 157461920 |
|---|---|
| PubChem CID | 157461920 |
| Molecular Formula | C18H27B2NO2 |
| Molecular Weight | 311.04 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | — |
| SMILES | O[C@@H]1CCN([C@@H]2CCCC[C@H]2OCCc2ccccc2)C1.[B].[B] |
| InChI | InChI=1S/C18H27NO2.2B/c20-16-10-12-19(14-16)17-8-4-5-9-18(17)21-13-11-15-6-2-1-3-7-15;;/h1-3,6-7,16-18,20H,4-5,8-14H2;;/t16-,17-,18-;;/m1../s1 |
| InChIKey | UQXAONNOKMNDSY-YMOMNUMFSA-N |
| XLogP | 1.86 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.04 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|