About 2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate
2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate (PubChem CID 157468415) has the molecular formula C30H42O3
and a molecular weight of 450.66 g/mol. Its IUPAC name is 2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate.
Molecular Properties
| Compound Name | 2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate |
| PubChem CID | 157468415 |
| Molecular Formula | C30H42O3 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | 2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(C)C)cc1CC=C(C)C.CC(C)=CCc1cc(C(C)C)ccc1O |
| InChI | InChI=1S/C16H22O2.C14H20O/c1-11(2)6-7-15-10-14(12(3)4)8-9-16(15)18-13(5)17;1-10(2)5-6-13-9-12(11(3)4)7-8-14(13)15/h6,8-10,12H,7H2,1-5H3;5,7-9,11,15H,6H2,1-4H3 |
| InChIKey | BUSWVNWVMYJCIT-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate?
The IUPAC name of 2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate (CID 157468415) is 2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate.
What is the SMILES notation for 2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate?
The canonical SMILES for 2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate is CC(=O)Oc1ccc(C(C)C)cc1CC=C(C)C.CC(C)=CCc1cc(C(C)C)ccc1O.
What is the InChIKey of 2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate?
The InChIKey is BUSWVNWVMYJCIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O2.C14H20O/c1-11(2)6-7-15-10-14(12(3)4)8-9-16(15)18-13(5)17;1-10(2)5-6-13-9-12(11(3)4)7-8-14(13)15/h6,8-10,12H,7H2,1-5H3;5,7-9,11,15H,6H2,1-4H3.
What are the key properties of 2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate?
2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate has a molecular weight of 450.66 g/mol, XLogP of 8.27, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbut-2-enyl)-4-propan-2-ylphenol;[2-(3-methylbut-2-enyl)-4-propan-2-ylphenyl] acetate is sourced from PubChem (CID 157468415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).