C23H27O4Os — CID 147263623
1-(2-hydroxy-4-methoxyphenyl)-3-[4-methoxy-3-(3-methylbut-2-enyl)phenyl]butan-1-one;osmium(1+) (PubChem CID 147263623) has the molecular formula C23H27O4Os and a molecular weight of 557.70 g/mol. Its IUPAC name is 1-(2-hydroxy-4-methoxyphenyl)-3-[4-methoxy-3-(3-methylbut-2-enyl)phenyl]butan-1-one;osmium(1+).
| Compound Name | 1-(2-hydroxy-4-methoxyphenyl)-3-[4-methoxy-3-(3-methylbut-2-enyl)phenyl]butan-1-one;osmium(1+) |
|---|---|
| PubChem CID | 147263623 |
| Molecular Formula | C23H27O4Os |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | 1-(2-hydroxy-4-methoxyphenyl)-3-[4-methoxy-3-(3-methylbut-2-enyl)phenyl]butan-1-one;osmium(1+) |
| SMILES | [CH2-]C(CC(=O)c1ccc(OC)cc1O)c1ccc(OC)c(CC=C(C)C)c1.[Os+] |
| InChI | InChI=1S/C23H27O4.Os/c1-15(2)6-7-18-13-17(8-11-23(18)27-5)16(3)12-21(24)20-10-9-19(26-4)14-22(20)25;/h6,8-11,13-14,16,25H,3,7,12H2,1-2,4-5H3;/q-1;+1 |
| InChIKey | LCLQCCMMCOXRKN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|