C25H30O7 — CID 42600506
methyl 3-[2,4-dimethoxy-5-(3-methylbut-2-enyl)phenyl]-2-(2,4-dimethoxyphenyl)-3-oxopropanoate (PubChem CID 42600506) has the molecular formula C25H30O7 and a molecular weight of 442.51 g/mol. Its IUPAC name is methyl 3-[2,4-dimethoxy-5-(3-methylbut-2-enyl)phenyl]-2-(2,4-dimethoxyphenyl)-3-oxopropanoate.
| Compound Name | methyl 3-[2,4-dimethoxy-5-(3-methylbut-2-enyl)phenyl]-2-(2,4-dimethoxyphenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 42600506 |
| Molecular Formula | C25H30O7 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | methyl 3-[2,4-dimethoxy-5-(3-methylbut-2-enyl)phenyl]-2-(2,4-dimethoxyphenyl)-3-oxopropanoate |
| SMILES | COC(=O)C(C(=O)c1cc(CC=C(C)C)c(OC)cc1OC)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C25H30O7/c1-15(2)8-9-16-12-19(22(31-6)14-20(16)29-4)24(26)23(25(27)32-7)18-11-10-17(28-3)13-21(18)30-5/h8,10-14,23H,9H2,1-7H3 |
| InChIKey | DPZNGWBNUSAFFZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|