C64H61N — CID 157470286
2',7'-ditert-butyl-N-(9,9-dimethylfluoren-3-yl)-N-[2-[4-(1,1,1-trideuterio-2-methylpropan-2-yl)phenyl]phenyl]-9,9'-spirobi[fluorene]-2-amine (PubChem CID 157470286) has the molecular formula C64H61N and a molecular weight of 847.22 g/mol. Its IUPAC name is 2',7'-ditert-butyl-N-(9,9-dimethylfluoren-3-yl)-N-[2-[4-(1,1,1-trideuterio-2-methylpropan-2-yl)phenyl]phenyl]-9,9'-spirobi[fluorene]-2-amine.
| Compound Name | 2',7'-ditert-butyl-N-(9,9-dimethylfluoren-3-yl)-N-[2-[4-(1,1,1-trideuterio-2-methylpropan-2-yl)phenyl]phenyl]-9,9'-spirobi[fluorene]-2-amine |
|---|---|
| PubChem CID | 157470286 |
| Molecular Formula | C64H61N |
| Molecular Weight | 847.22 g/mol |
| Exact Mass | 846.50 |
| IUPAC Name | 2',7'-ditert-butyl-N-(9,9-dimethylfluoren-3-yl)-N-[2-[4-(1,1,1-trideuterio-2-methylpropan-2-yl)phenyl]phenyl]-9,9'-spirobi[fluorene]-2-amine |
| SMILES | [2H]C([2H])([2H])C(C)(C)c1ccc(-c2ccccc2N(c2ccc3c(c2)-c2ccccc2C3(C)C)c2ccc3c(c2)C2(c4ccccc4-3)c3cc(C(C)(C)C)ccc3-c3ccc(C(C)(C)C)cc32)cc1 |
| InChI | InChI=1S/C64H61N/c1-60(2,3)41-26-24-40(25-27-41)46-18-14-17-23-59(46)65(44-31-35-54-52(38-44)48-20-12-15-21-53(48)63(54,10)11)45-30-34-51-47-19-13-16-22-55(47)64(58(51)39-45)56-36-42(61(4,5)6)28-32-49(56)50-33-29-43(37-57(50)64)62(7,8)9/h12-39H,1-11H3/i1D3 |
| InChIKey | PWQIOIXNRLCSSF-FIBGUPNXSA-N |
| XLogP | 17.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.22 |
| LogP ≤ 5 | 17.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |